CAS 832740-33-7
:2-Amino-4-(2,4-dichlorophenyl)-5-methyl-3-thiophenecarboxamide
Description:
2-Amino-4-(2,4-dichlorophenyl)-5-methyl-3-thiophenecarboxamide is a chemical compound characterized by its complex structure, which includes an amino group, a thiophene ring, and a dichlorophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the amino and carboxamide functional groups. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, and may exhibit varying degrees of stability depending on environmental conditions such as pH and temperature. The dichlorophenyl group suggests potential applications in pharmaceuticals or agrochemicals, as halogenated compounds often possess unique reactivity and biological properties. Additionally, the presence of the thiophene ring may contribute to its electronic properties, making it of interest in materials science and organic electronics. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C12H10Cl2N2OS
InChI:InChI=1S/C12H10Cl2N2OS/c1-5-9(10(11(15)17)12(16)18-5)7-3-2-6(13)4-8(7)14/h2-4H,16H2,1H3,(H2,15,17)
InChI key:InChIKey=KBGKOTUVUZBOFQ-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C(=C(C)SC1N)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- 2-Amino-4-(2,4-dichlorophenyl)-5-methyl-3-thiophenecarboxamide
- 3-Thiophenecarboxamide, 2-amino-4-(2,4-dichlorophenyl)-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.