CAS 832740-36-0

4-[(4-Chloro-3,5-dimethylphenoxy)methyl]benzoic acid hydrazide

Description:

4-[(4-Chloro-3,5-dimethylphenoxy)methyl]benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is linked to a benzoic acid moiety. This compound features a chlorinated aromatic ring, specifically a 4-chloro-3,5-dimethylphenoxy group, contributing to its unique properties. The presence of the hydrazide functional group suggests potential reactivity, particularly in forming hydrazones or undergoing condensation reactions. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs or agrochemicals. Its solubility, stability, and reactivity can be influenced by the substituents on the aromatic rings, as well as the overall molecular structure. Additionally, the presence of chlorine and methyl groups can affect its lipophilicity and interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₆H₁₇ClN₂O₂

InChI: InChI=1S/C16H17ClN2O2/c1-10-7-14(8-11(2)15(10)17)21-9-12-3-5-13(6-4-12)16(20)19-18/h3-8H,9,18H2,1-2H3,(H,19,20)

InChI key: InChIKey=QCDWPORENMKGAV-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=CC=C(COC2=CC(C)=C(Cl)C(C)=C2)C=C1

Synonyms:

• Benzoic acid, 4-[(4-chloro-3,5-dimethylphenoxy)methyl]-, hydrazide
• 4-[(4-Chloro-3,5-dimethylphenoxy)methyl]benzoic acid hydrazide