CAS 832740-37-1

5-(3-Hydroxyphenyl)-3-isoxazolecarboxylic acid

Description:

5-(3-Hydroxyphenyl)-3-isoxazolecarboxylic acid, identified by its CAS number 832740-37-1, is a chemical compound that features a unique isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance is characterized by the presence of a carboxylic acid functional group and a hydroxyl group on a phenyl ring, contributing to its potential as a bioactive molecule. The hydroxyl group can enhance its solubility in polar solvents and may also participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. The isoxazole moiety is known for its role in various pharmacological activities, making this compound of interest in medicinal chemistry. Additionally, the compound's structural features suggest potential applications in drug development, particularly in areas related to anti-inflammatory or analgesic properties. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.

Formula: C₁₀H₇NO₄

InChI: InChI=1S/C10H7NO4/c12-7-3-1-2-6(4-7)9-5-8(10(13)14)11-15-9/h1-5,12H,(H,13,14)

InChI key: InChIKey=ISLIVLUJZHTSRK-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(ON1)C2=CC(O)=CC=C2

Synonyms:

• 3-Isoxazolecarboxylic acid, 5-(3-hydroxyphenyl)-
• 5-(3-Hydroxyphenyl)isoxazole-3-carboxylic acid
• 5-(3-Hydroxyphenyl)-3-isoxazolecarboxylic acid

5-(3-Hydroxyphenyl)isoxazole-3-carboxylic acid

CAS: 832740-37-1

Please enquire for more information about 5-(3-Hydroxyphenyl)isoxazole-3-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₀H₇NO₄

Purity: Min. 95%

Molecular weight: 205.17 g/mol

Ref: 3D-FH119752