CAS 832740-38-2
:2-[[5-[2-(4-Chlorophenyl)cyclopropyl]-4-ethyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide
Description:
2-[[5-[2-(4-Chlorophenyl)cyclopropyl]-4-ethyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide is a chemical compound characterized by its complex structure, which includes a triazole ring, a cyclopropyl group, and a hydrazide functional group. The presence of the 4-chlorophenyl moiety contributes to its potential biological activity, while the ethyl group and thioacetic acid component may influence its solubility and reactivity. This compound is likely to exhibit properties typical of hydrazides, such as potential antimicrobial or antifungal activity, due to the presence of the triazole ring, which is known for its role in various pharmacological applications. The specific interactions and stability of this compound can be influenced by factors such as pH, temperature, and solvent polarity. As with many synthetic organic compounds, its synthesis and characterization would involve techniques such as NMR, mass spectrometry, and IR spectroscopy to confirm its structure and purity. Further studies would be necessary to elucidate its full range of biological activities and potential applications in medicinal chemistry.
Formula:C15H18ClN5OS
InChI:InChI=1S/C15H18ClN5OS/c1-2-21-14(19-20-15(21)23-8-13(22)18-17)12-7-11(12)9-3-5-10(16)6-4-9/h3-6,11-12H,2,7-8,17H2,1H3,(H,18,22)
InChI key:InChIKey=AAVCCTUSLWZLMF-UHFFFAOYSA-N
SMILES:C(C)N1C(C2C(C2)C3=CC=C(Cl)C=C3)=NN=C1SCC(NN)=O
Synonyms:- 2-[[5-[2-(4-Chlorophenyl)cyclopropyl]-4-ethyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide
- Acetic acid, [[5-[2-(4-chlorophenyl)cyclopropyl]-4-ethyl-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
- Acetic acid, 2-[[5-[2-(4-chlorophenyl)cyclopropyl]-4-ethyl-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.