CAS 832740-41-7
:4-(Difluoromethoxy)-3-ethoxybenzenamine
Description:
4-(Difluoromethoxy)-3-ethoxybenzenamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an ethoxy group and a difluoromethoxy group. The presence of the difluoromethoxy group introduces two fluorine atoms attached to a methoxy group, enhancing the compound's reactivity and potentially influencing its electronic properties. The ethoxy group contributes to the overall hydrophobic character of the molecule, which may affect its solubility in various solvents. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its interactions in biological systems or chemical reactions. Additionally, the specific arrangement of substituents on the benzene ring can lead to unique steric and electronic effects, making it of interest in medicinal chemistry and material science. Overall, the combination of these functional groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis.
Formula:C9H11F2NO2
InChI:InChI=1S/C9H11F2NO2/c1-2-13-8-5-6(12)3-4-7(8)14-9(10)11/h3-5,9H,2,12H2,1H3
InChI key:InChIKey=VHQPLOXJAZUAOY-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=C(OCC)C=C(N)C=C1
Synonyms:- Benzenamine, 4-(difluoromethoxy)-3-ethoxy-
- 4-(Difluoromethoxy)-3-ethoxybenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Difluoromethoxy-3-ethoxy-phenylamine
CAS:Formula:C9H11F2NO2Color and Shape:SolidMolecular weight:203.189
