CAS 832740-42-8

5-[(2,4-Difluorophenoxy)methyl]-2-furancarboxylic acid

Description:

5-[(2,4-Difluorophenoxy)methyl]-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a carboxylic acid functional group. The presence of the 2,4-difluorophenoxy group contributes to its potential biological activity and solubility properties. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the carboxylic acid group, which can participate in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of herbicides or other bioactive agents. The difluorophenoxy moiety may enhance the compound's lipophilicity and selectivity towards specific biological targets. Additionally, the compound's stability and reactivity can be influenced by the presence of the fluorine atoms, which can affect electronic properties and steric hindrance. Overall, 5-[(2,4-Difluorophenoxy)methyl]-2-furancarboxylic acid represents a compound of interest in various fields of chemical research and application.

Formula: C₁₂H₈F₂O₄

InChI: InChI=1S/C12H8F2O4/c13-7-1-3-10(9(14)5-7)17-6-8-2-4-11(18-8)12(15)16/h1-5H,6H2,(H,15,16)

InChI key: InChIKey=LANXWLNRDPXBLQ-UHFFFAOYSA-N

SMILES: C(OC1=C(F)C=C(F)C=C1)C=2OC(C(O)=O)=CC2

Synonyms:

• 5-[(2,4-Difluorophenoxy)methyl]-2-furancarboxylic acid
• 2-Furancarboxylic acid, 5-[(2,4-difluorophenoxy)methyl]-