CAS 832740-47-3

2-[4-(1H-Tetrazol-1-yl)phenoxy]acetic acid

Description:

2-[4-(1H-Tetrazol-1-yl)phenoxy]acetic acid, with the CAS number 832740-47-3, is a chemical compound characterized by its unique structure that includes a phenoxy group and a tetrazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their role in pharmaceuticals and agrochemicals. The compound may display acidic behavior due to the carboxylic acid group, which can donate protons in solution. Additionally, its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Overall, 2-[4-(1H-Tetrazol-1-yl)phenoxy]acetic acid is a compound with promising characteristics for further research and application in various fields, including drug development and agricultural science.

Formula: C₉H₈N₄O₃

InChI: InChI=1S/C9H8N4O3/c14-9(15)5-16-8-3-1-7(2-4-8)13-6-10-11-12-13/h1-4,6H,5H2,(H,14,15)

InChI key: InChIKey=LFHALYQHTJOQOT-UHFFFAOYSA-N

SMILES: O(CC(O)=O)C1=CC=C(C=C1)N2C=NN=N2

Synonyms:

• (4-Tetrazol-1-yl-phenoxy)-acetic acid
• 2-[4-(1H-1,2,3,4-Tetrazol-1-yl)phenoxy]acetic acid
• 2-[4-(1H-Tetrazol-1-yl)phenoxy]acetic acid
• 2-[4-(Tetrazol-1-yl)phenoxy]acetic acid
• Acetic acid, 2-[4-(1H-tetrazol-1-yl)phenoxy]-
• Acetic acid, [4-(1H-tetrazol-1-yl)phenoxy]-
• [4-(1H-Tetraazol-1-yl)phenoxy]acetic acid

2-[4-(1H-1,2,3,4-tetrazol-1-yl)phenoxy]acetic acid

CAS: 832740-47-3

Formula: C₉H₈N₄O₃

Molecular weight: 220.1848

Ref: IN-DA00G2RC

(4-Tetrazol-1-yl-phenoxy)-acetic acid

CAS: 832740-47-3

Formula: C₉H₈N₄O₃

Purity: 95.0%

Molecular weight: 220.188

Ref: 10-F028144