CymitQuimica logo

CAS 832740-49-5

:

1-[(2-Methylphenyl)methyl]-1H-1,2,4-triazol-3-amine

Description:
1-[(2-Methylphenyl)methyl]-1H-1,2,4-triazol-3-amine is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a 2-methylphenyl group attached to a methyl group, contributing to its unique properties and potential biological activity. The presence of the amine functional group indicates that it can participate in hydrogen bonding, which may enhance its solubility and reactivity in various chemical environments. The compound is likely to exhibit moderate lipophilicity due to the aromatic ring, which can influence its interaction with biological systems. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of antifungal or antimicrobial agents, as triazole derivatives are known for their efficacy in these areas. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the triazole ring, making it a subject of interest in medicinal chemistry and material science.
Formula:C10H12N4
InChI:InChI=1S/C10H12N4/c1-8-4-2-3-5-9(8)6-14-7-12-10(11)13-14/h2-5,7H,6H2,1H3,(H2,11,13)
InChI key:InChIKey=OVXMGVHCYCVRGA-UHFFFAOYSA-N
SMILES:C(C1=C(C)C=CC=C1)N2N=C(N)N=C2
Synonyms:
  • 1-[(2-Methylphenyl)methyl]-1H-1,2,4-triazol-3-amine
  • 1H-1,2,4-Triazol-3-amine, 1-[(2-methylphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.