CAS 832740-76-8
:4,4-Difluoro-1-(3-methoxyphenyl)-1,3-butanedione
Description:
4,4-Difluoro-1-(3-methoxyphenyl)-1,3-butanedione, identified by its CAS number 832740-76-8, is an organic compound characterized by its unique structure that includes a butanedione core substituted with two fluorine atoms and a methoxyphenyl group. This compound typically exhibits properties associated with diketones, such as being a potential precursor in organic synthesis and pharmaceutical applications. The presence of fluorine atoms often enhances the compound's lipophilicity and metabolic stability, making it of interest in medicinal chemistry. The methoxy group contributes to the compound's electronic properties, potentially influencing its reactivity and interaction with biological targets. Additionally, the compound may display interesting spectroscopic characteristics, such as distinct UV-Vis and NMR signals, due to its functional groups. Overall, 4,4-Difluoro-1-(3-methoxyphenyl)-1,3-butanedione is a versatile compound with potential applications in various fields, including drug development and materials science.
Formula:C11H10F2O3
InChI:InChI=1S/C11H10F2O3/c1-16-8-4-2-3-7(5-8)9(14)6-10(15)11(12)13/h2-5,11H,6H2,1H3
InChI key:InChIKey=UZFAUAGBMNFLMX-UHFFFAOYSA-N
SMILES:C(CC(C(F)F)=O)(=O)C1=CC(OC)=CC=C1
Synonyms:- 4,4-Difluoro-1-(3-methoxyphenyl)-1,3-butanedione
- 1,3-Butanedione, 4,4-difluoro-1-(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.