CAS 832740-80-4

3-[(3,4-Diethoxyphenyl)methoxy]benzaldehyde

Description:

3-[(3,4-Diethoxyphenyl)methoxy]benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a methoxy group attached to a phenyl ring that is further substituted with diethoxy groups. This compound typically exhibits properties common to aldehydes, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic nature. The presence of multiple ethoxy groups enhances its lipophilicity, which can influence its reactivity and interactions in various chemical environments. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic reactions, including ether formation and aldehyde synthesis, and it may be analyzed using techniques such as NMR and mass spectrometry for structural confirmation.

Formula: C₁₈H₂₀O₄

InChI: InChI=1S/C18H20O4/c1-3-20-17-9-8-15(11-18(17)21-4-2)13-22-16-7-5-6-14(10-16)12-19/h5-12H,3-4,13H2,1-2H3

InChI key: InChIKey=KDQDWYICHJYQOR-UHFFFAOYSA-N

SMILES: O(CC)C1=C(OCC)C=CC(COC2=CC(C=O)=CC=C2)=C1

Synonyms:

• 3-[(3,4-Diethoxyphenyl)methoxy]benzaldehyde
• Benzaldehyde, 3-[(3,4-diethoxyphenyl)methoxy]-