CAS 832740-86-0
:3-(4-Methylphenoxy)-5-nitrobenzenamine
Description:
3-(4-Methylphenoxy)-5-nitrobenzenamine, with the CAS number 832740-86-0, is an organic compound characterized by its aromatic structure, which includes a nitro group and an amine functional group. This compound features a 4-methylphenoxy group attached to a benzene ring that also carries a nitro substituent at the 5-position and an amino group at the 3-position. The presence of the nitro group typically imparts electrophilic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The amine group can participate in hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data and handling precautions should be considered, as compounds with nitro and amine functionalities can pose health risks. Overall, 3-(4-Methylphenoxy)-5-nitrobenzenamine is a compound of interest in both synthetic and medicinal chemistry.
Formula:C13H12N2O3
InChI:InChI=1S/C13H12N2O3/c1-9-2-4-12(5-3-9)18-13-7-10(14)6-11(8-13)15(16)17/h2-8H,14H2,1H3
InChI key:InChIKey=KJBYENUMKKEWJZ-UHFFFAOYSA-N
SMILES:O(C1=CC(N(=O)=O)=CC(N)=C1)C2=CC=C(C)C=C2
Synonyms:- 3-(4-Methylphenoxy)-5-nitrobenzenamine
- 3-Nitro-5-p-tolyloxy-phenylamine
- Benzenamine, 3-(4-methylphenoxy)-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.