CAS 832740-88-2

5-[4-(Difluoromethoxy)phenyl]-2H-tetrazole

Description:

5-[4-(Difluoromethoxy)phenyl]-2H-tetrazole, with the CAS number 832740-88-2, is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a phenyl group substituted with a difluoromethoxy group, enhancing its chemical reactivity and potential applications. The difluoromethoxy group contributes to the compound's lipophilicity and may influence its biological activity. Tetrazoles are known for their diverse applications in pharmaceuticals, agrochemicals, and materials science due to their ability to form stable complexes with metal ions and their potential as bioisosteres for carboxylic acids. The presence of fluorine atoms often imparts unique electronic properties, making such compounds of interest in medicinal chemistry for developing new therapeutic agents. Overall, 5-[4-(Difluoromethoxy)phenyl]-2H-tetrazole is a compound of interest for further research and development in various chemical and biological fields.

Formula: C₈H₆F₂N₄O

InChI: InChI=1S/C8H6F2N4O/c9-8(10)15-6-3-1-5(2-4-6)7-11-13-14-12-7/h1-4,8H,(H,11,12,13,14)

InChI key: InChIKey=RUBKYAZIXMYFTQ-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=CC=C(C=C1)C=2NN=NN2

5-(4-Difluoromethoxy-phenyl)-2H-tetrazole

CAS: 832740-88-2

Versatile small molecule scaffold

Formula: C₈H₆F₂N₄O

Purity: Min. 95%

Molecular weight: 212.16 g/mol

Ref: 3D-HIB74088