CAS 832740-89-3

5-[(4-Methylphenoxy)methyl]-2-furancarboxylic acid

Description:

5-[(4-Methylphenoxy)methyl]-2-furancarboxylic acid, identified by its CAS number 832740-89-3, is an organic compound characterized by its furan and carboxylic acid functional groups. This compound features a furan ring, which is a five-membered aromatic ring containing oxygen, and a carboxylic acid group (-COOH) that contributes to its acidity and reactivity. The presence of the 4-methylphenoxy group indicates that it has a phenolic structure with a methyl substituent, enhancing its hydrophobic characteristics and potentially influencing its solubility in organic solvents. The compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its structural features suggest potential applications in drug development, particularly in the design of compounds with specific biological targets. Additionally, the compound's stability and reactivity can be influenced by the presence of the furan and carboxylic acid moieties, which may participate in various chemical reactions, including esterification and amidation. Overall, this compound represents a unique combination of functional groups that may offer diverse applications in chemical synthesis and medicinal chemistry.

Formula: C₁₃H₁₂O₄

InChI: InChI=1S/C13H12O4/c1-9-2-4-10(5-3-9)16-8-11-6-7-12(17-11)13(14)15/h2-7H,8H2,1H3,(H,14,15)

InChI key: InChIKey=DHFHOLRIPOTVQX-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(C)C=C1)C=2OC(C(O)=O)=CC2

Synonyms:

• 2-Furancarboxylic acid, 5-[(4-methylphenoxy)methyl]-
• 5-[(4-Methylphenoxy)methyl]-2-furancarboxylic acid

5-(4-Methylphenoxymethyl)furan-2-carboxylic acid

CAS: 832740-89-3

Versatile small molecule scaffold

Formula: C₁₃H₁₂O₄

Purity: Min. 95%

Molecular weight: 232.23 g/mol

Ref: 3D-HIB74089