CAS 832740-92-8

Ethyl 5-cyclopropyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate

Description:

Ethyl 5-cyclopropyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate, with the CAS number 832740-92-8, is a synthetic organic compound characterized by its complex bicyclic structure, which includes a pyrazolo-pyrimidine framework. This compound features a cyclopropyl group and a difluoromethyl substituent, contributing to its unique chemical properties and potential biological activity. The presence of the ethyl ester functional group indicates that it may exhibit moderate lipophilicity, which can influence its solubility and permeability in biological systems. The tetrahydro configuration suggests that the compound may exist in multiple conformations, potentially affecting its interaction with biological targets. Such compounds are often investigated for their pharmacological properties, including potential roles as enzyme inhibitors or in other therapeutic applications. Overall, the structural complexity and specific substituents of this compound make it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₃H₁₇F₂N₃O₂

InChI: InChI=1S/C13H17F2N3O2/c1-2-20-13(19)8-6-16-18-10(11(14)15)5-9(7-3-4-7)17-12(8)18/h6-7,9-11,17H,2-5H2,1H3

InChI key: InChIKey=JXOCISZRSNXSGP-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C2N(C(C(F)F)CC(N2)C3CC3)N=C1

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 5-cyclopropyl-7-(difluoromethyl)-4,5,6,7-tetrahydro-, ethyl ester
• Ethyl 5-cyclopropyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate