CAS 832740-94-0
:3-[(2,4-Dimethylphenoxy)methyl]benzoic acid hydrazide
Description:
3-[(2,4-Dimethylphenoxy)methyl]benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from benzoic acid. This compound features a 2,4-dimethylphenoxy group, indicating the presence of a phenolic structure with two methyl substituents at the 2 and 4 positions, contributing to its hydrophobic characteristics. The hydrazide moiety suggests potential reactivity, particularly in forming hydrazones or undergoing condensation reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important for its application in various chemical processes. Additionally, the presence of both aromatic and hydrophilic groups may influence its interaction with biological systems, potentially affecting its pharmacokinetics and pharmacodynamics. Overall, 3-[(2,4-Dimethylphenoxy)methyl]benzoic acid hydrazide is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C16H18N2O2
InChI:InChI=1S/C16H18N2O2/c1-11-6-7-15(12(2)8-11)20-10-13-4-3-5-14(9-13)16(19)18-17/h3-9H,10,17H2,1-2H3,(H,18,19)
InChI key:InChIKey=NLVQOILKINMFIW-UHFFFAOYSA-N
SMILES:C(OC1=C(C)C=C(C)C=C1)C2=CC(C(NN)=O)=CC=C2
Synonyms:- 3-[(2,4-Dimethylphenoxy)methyl]benzoic acid hydrazide
- Benzoic acid, 3-[(2,4-dimethylphenoxy)methyl]-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.