CAS 832740-95-1

3-[(2,3-Dichlorophenoxy)methyl]benzoic acid

Description:

3-[(2,3-Dichlorophenoxy)methyl]benzoic acid, identified by its CAS number 832740-95-1, is an organic compound characterized by its benzoic acid structure substituted with a dichlorophenoxy group. This compound typically exhibits properties associated with both aromatic compounds and carboxylic acids, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic components. The presence of the dichlorophenoxy moiety suggests potential biological activity, as chlorinated phenolic compounds are often studied for their herbicidal or antimicrobial properties. The compound may also display moderate to high melting and boiling points, indicative of strong intermolecular interactions such as hydrogen bonding and π-π stacking. Its chemical reactivity is influenced by the carboxylic acid functional group, which can participate in various reactions, including esterification and acid-base reactions. Overall, 3-[(2,3-Dichlorophenoxy)methyl]benzoic acid is of interest in both synthetic organic chemistry and potential applications in agrochemicals or pharmaceuticals.

Formula: C₁₄H₁₀Cl₂O₃

InChI: InChI=1S/C14H10Cl2O3/c15-11-5-2-6-12(13(11)16)19-8-9-3-1-4-10(7-9)14(17)18/h1-7H,8H2,(H,17,18)

InChI key: InChIKey=BQPYAKYXWINEQQ-UHFFFAOYSA-N

SMILES: O(CC1=CC(C(O)=O)=CC=C1)C2=C(Cl)C(Cl)=CC=C2

Synonyms:

• Benzoic acid, 3-[(2,3-dichlorophenoxy)methyl]-
• 3-[(2,3-Dichlorophenoxy)methyl]benzoic acid

3-[(2,3-Dichlorophenoxy)methyl]benzoic acid

CAS: 832740-95-1

Versatile small molecule scaffold

Formula: C₁₄H₁₀Cl₂O₃

Purity: Min. 95%

Molecular weight: 297.1 g/mol

Ref: 3D-HIB74095