CAS 832741-02-3
:3-Cyclopropyl-2-thioxo-1,3-diazaspiro[4.5]decan-4-one
Description:
3-Cyclopropyl-2-thioxo-1,3-diazaspiro[4.5]decan-4-one is a chemical compound characterized by its unique spirocyclic structure, which includes a cyclopropyl group and a thioxo functional group. This compound features a diaza framework, indicating the presence of two nitrogen atoms within its ring system. The thioxo group, which contains sulfur, contributes to its reactivity and potential biological activity. The spirocyclic nature of the compound suggests interesting conformational properties, which can influence its interactions with biological targets. Typically, compounds with such structures may exhibit diverse pharmacological activities, making them of interest in medicinal chemistry. The presence of the cyclopropyl moiety can enhance the compound's lipophilicity and may affect its binding affinity to various receptors or enzymes. Overall, 3-Cyclopropyl-2-thioxo-1,3-diazaspiro[4.5]decan-4-one represents a complex and potentially bioactive molecule, warranting further investigation for its chemical properties and applications in drug development.
Formula:C11H16N2OS
InChI:InChI=1S/C11H16N2OS/c14-9-11(6-2-1-3-7-11)12-10(15)13(9)8-4-5-8/h8H,1-7H2,(H,12,15)
InChI key:InChIKey=KYRIFJPFGUVNIP-UHFFFAOYSA-N
SMILES:O=C1C2(NC(=S)N1C3CC3)CCCCC2
Synonyms:- 3-Cyclopropyl-2-thioxo-1,3-diazaspiro[4.5]decan-4-one
- 1,3-Diazaspiro[4.5]decan-4-one, 3-cyclopropyl-2-thioxo-
- ART-CHEM-BB B022224
- 3-CYCLOPROPYL-2-THIOXO-1,3-DIAZA-SPIRO[4.5]DECAN-4-ONE
- AKOS B022224
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.