CAS 832741-13-6

1-[(2-Chlorophenyl)methyl]-3-piperidinecarboxylic acid hydrazide

Description:

1-[(2-Chlorophenyl)methyl]-3-piperidinecarboxylic acid hydrazide, identified by its CAS number 832741-13-6, is a chemical compound characterized by its hydrazide functional group, which is linked to a piperidine ring and a chlorophenyl moiety. This compound typically exhibits properties associated with both hydrazides and piperidine derivatives, including potential biological activity. The presence of the 2-chlorophenyl group may influence its lipophilicity and reactivity, making it of interest in medicinal chemistry. Hydrazides are known for their ability to form stable complexes with metal ions and can participate in various chemical reactions, such as condensation and oxidation. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of agents with antimicrobial or anti-inflammatory properties. However, specific characteristics such as solubility, melting point, and stability would require empirical data for precise evaluation. Overall, this compound represents a class of organic molecules that may have significant implications in drug design and development.

Formula: C₁₃H₁₈ClN₃O

InChI: InChI=1S/C13H18ClN3O/c14-12-6-2-1-4-10(12)8-17-7-3-5-11(9-17)13(18)16-15/h1-2,4,6,11H,3,5,7-9,15H2,(H,16,18)

InChI key: InChIKey=WDFVVZLFMBOXLU-UHFFFAOYSA-N

SMILES: C(N1CC(C(NN)=O)CCC1)C2=C(Cl)C=CC=C2

Synonyms:

• 1-[(2-Chlorophenyl)methyl]-3-piperidinecarboxylic acid hydrazide
• 3-Piperidinecarboxylic acid, 1-[(2-chlorophenyl)methyl]-, hydrazide