CAS 832741-16-9

4-[(3-Nitro-1H-1,2,4-triazol-1-yl)methyl]benzoic acid hydrazide

Description:

4-[(3-Nitro-1H-1,2,4-triazol-1-yl)methyl]benzoic acid hydrazide is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety linked to a hydrazide functional group and a 3-nitro-1H-1,2,4-triazole substituent. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of both hydrophilic and hydrophobic regions in its structure. The nitro group contributes to its potential reactivity and may impart biological activity, making it of interest in pharmaceutical research. The hydrazide functional group can participate in various chemical reactions, including hydrazone formation and coupling reactions, which are valuable in synthetic chemistry. Additionally, the presence of the triazole ring may enhance the compound's stability and influence its interaction with biological targets. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and materials science, particularly in the development of new therapeutic agents.

Formula: C₁₀H₁₀N₆O₃

InChI: InChI=1S/C10H10N6O3/c11-13-9(17)8-3-1-7(2-4-8)5-15-6-12-10(14-15)16(18)19/h1-4,6H,5,11H2,(H,13,17)

InChI key: InChIKey=PZXLKNUDRRLMPR-UHFFFAOYSA-N

SMILES: C(N1N=C(N(=O)=O)N=C1)C2=CC=C(C(NN)=O)C=C2

Synonyms:

• Benzoic acid, 4-[(3-nitro-1H-1,2,4-triazol-1-yl)methyl]-, hydrazide
• 4-[(3-Nitro-1H-1,2,4-triazol-1-yl)methyl]benzoic acid hydrazide