CAS 832741-17-0

4-[(2,6-Dimethylphenoxy)methyl]benzoic acid hydrazide

Description:

4-[(2,6-Dimethylphenoxy)methyl]benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from benzoic acid. This compound features a hydrophobic aromatic structure due to the presence of a 2,6-dimethylphenoxy group, contributing to its potential solubility properties and interactions in various environments. The hydrazide moiety can participate in hydrogen bonding, making it relevant in biological and pharmaceutical applications. The presence of the benzoic acid derivative suggests potential acidity, which may influence its reactivity and stability. This compound may exhibit biological activity, possibly serving as a scaffold for drug development or as a reagent in organic synthesis. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is used. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₆H₁₈N₂O₂

InChI: InChI=1S/C16H18N2O2/c1-11-4-3-5-12(2)15(11)20-10-13-6-8-14(9-7-13)16(19)18-17/h3-9H,10,17H2,1-2H3,(H,18,19)

InChI key: InChIKey=KMUAHUDITDEIQQ-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(C(NN)=O)C=C1)C2=C(C)C=CC=C2C

Synonyms:

• 4-[(2,6-Dimethylphenoxy)methyl]benzoic acid hydrazide
• Benzoic acid, 4-[(2,6-dimethylphenoxy)methyl]-, hydrazide