CAS 832741-21-6

4-[(2,4-Dimethylphenoxy)methyl]benzoic acid hydrazide

Description:

4-[(2,4-Dimethylphenoxy)methyl]benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from benzoic acid. This compound features a 2,4-dimethylphenoxy group, contributing to its hydrophobic characteristics and potential biological activity. The presence of the hydrazide moiety suggests that it may participate in various chemical reactions, such as hydrazone formation or serve as a potential ligand in coordination chemistry. The compound's structure indicates it may exhibit moderate solubility in organic solvents, while its hydrophilic carboxylic acid group could enhance solubility in polar solvents. Additionally, the presence of multiple functional groups may impart interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its CAS number, 832741-21-6, allows for easy identification in chemical databases. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and reactivity.

Formula: C₁₆H₁₈N₂O₂

InChI: InChI=1S/C16H18N2O2/c1-11-3-8-15(12(2)9-11)20-10-13-4-6-14(7-5-13)16(19)18-17/h3-9H,10,17H2,1-2H3,(H,18,19)

InChI key: InChIKey=MXNUEXIFUQTSKF-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(C(NN)=O)C=C1)C2=C(C)C=C(C)C=C2

Synonyms:

• 4-[(2,4-Dimethylphenoxy)methyl]benzoic acid hydrazide
• Benzoic acid, 4-[(2,4-dimethylphenoxy)methyl]-, hydrazide