CAS 832741-27-2
:Methyl 5-[(2-chloro-5-nitrophenoxy)methyl]-2-furancarboxylate
Description:
Methyl 5-[(2-chloro-5-nitrophenoxy)methyl]-2-furancarboxylate, identified by its CAS number 832741-27-2, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of a chloro and nitro substituent on the phenoxy group indicates potential for electrophilic substitution reactions, making it a candidate for various synthetic applications. The nitro group also suggests that the compound may exhibit interesting electronic properties, potentially influencing its reactivity and interactions with biological systems. Additionally, the furan moiety can participate in various chemical reactions, including polymerization and cycloaddition. Overall, this compound's unique structural features may lend it utility in medicinal chemistry, agrochemicals, or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of halogen and nitro groups, which can impart toxicity and environmental concerns.
Formula:C13H10ClNO6
InChI:InChI=1S/C13H10ClNO6/c1-19-13(16)11-5-3-9(21-11)7-20-12-6-8(15(17)18)2-4-10(12)14/h2-6H,7H2,1H3
InChI key:InChIKey=KZIHLDBMLYUOPD-UHFFFAOYSA-N
SMILES:O(CC=1OC(C(OC)=O)=CC1)C2=CC(N(=O)=O)=CC=C2Cl
Synonyms:- Methyl 5-[(2-chloro-5-nitrophenoxy)methyl]-2-furancarboxylate
- 2-Furancarboxylic acid, 5-[(2-chloro-5-nitrophenoxy)methyl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.