CymitQuimica logo

CAS 832741-29-4

:

1-(4-Bromo-5-propyl-2-thienyl)ethanone

Description:
1-(4-Bromo-5-propyl-2-thienyl)ethanone is an organic compound characterized by its thienyl structure, which incorporates a bromine substituent and a propyl group. The presence of the ethanone functional group indicates that it is a ketone, specifically featuring a carbonyl group (C=O) adjacent to an ethyl group. This compound is likely to exhibit moderate to high lipophilicity due to the presence of the propyl group and the aromatic thienyl ring, which can influence its solubility in organic solvents. The bromine atom introduces notable electronegativity, potentially affecting the compound's reactivity and interaction with other molecules. Additionally, the thienyl ring can participate in various chemical reactions, including electrophilic substitutions. The compound may have applications in organic synthesis, medicinal chemistry, or materials science, although specific uses would depend on further research into its biological activity and chemical properties. Safety data and handling precautions should be considered due to the presence of bromine, which can be hazardous.
Formula:C9H11BrOS
InChI:InChI=1S/C9H11BrOS/c1-3-4-8-7(10)5-9(12-8)6(2)11/h5H,3-4H2,1-2H3
InChI key:InChIKey=RVEBOXGTMJAMGA-UHFFFAOYSA-N
SMILES:C(CC)C=1SC(C(C)=O)=CC1Br
Synonyms:
  • 1-(4-Bromo-5-propyl-2-thienyl)ethanone
  • Ethanone, 1-(4-bromo-5-propyl-2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.