CAS 83275-56-3
:Ethyl N-[5-[2-(dimethylamino)acetyl]-10,11-dihydro-5H-dibenz[b,f]azepin-3-yl]carbamate
Description:
Ethyl N-[5-[2-(dimethylamino)acetyl]-10,11-dihydro-5H-dibenz[b,f]azepin-3-yl]carbamate, commonly referred to by its CAS number 83275-56-3, is a chemical compound characterized by its complex structure, which includes a dibenzazepine core. This compound features a carbamate functional group and a dimethylaminoacetyl substituent, contributing to its potential biological activity. It is typically classified as a pharmaceutical intermediate or a potential drug candidate, often investigated for its effects on the central nervous system due to the presence of the dibenzazepine moiety, which is known for its psychoactive properties. The compound is likely to exhibit moderate to high lipophilicity, influencing its absorption and distribution in biological systems. Additionally, its synthesis and stability can be affected by various factors, including pH and temperature. As with many compounds in medicinal chemistry, understanding its pharmacokinetics and pharmacodynamics is crucial for evaluating its therapeutic potential and safety profile.
Formula:C21H25N3O3
InChI:InChI=1S/C21H25N3O3/c1-4-27-21(26)22-17-12-11-16-10-9-15-7-5-6-8-18(15)24(19(16)13-17)20(25)14-23(2)3/h5-8,11-13H,4,9-10,14H2,1-3H3,(H,22,26)
InChI key:InChIKey=KJAMZCVTJDTESW-UHFFFAOYSA-N
SMILES:C(CN(C)C)(=O)N1C=2C(CCC=3C1=CC=CC3)=CC=C(NC(OCC)=O)C2
Synonyms:- 5H-Dibenz[b,f]azepine, carbamic acid deriv.
- Carbamic acid, N-[5-[2-(dimethylamino)acetyl]-10,11-dihydro-5H-dibenz[b,f]azepin-3-yl]-, ethyl ester
- Carbamic acid, [5-[(dimethylamino)acetyl]-10,11-dihydro-5H-dibenz[b,f]azepin-3-yl]-, ethyl ester
- Ethyl 5-(N,N-dimethylglycyl)-10,11-dihydro-5H-dibenz(b,f)azepine-3-carbamate
- Ethyl N-[5-[2-(dimethylamino)acetyl]-10,11-dihydro-5H-dibenz[b,f]azepin-3-yl]carbamate
- Tiracizina
- Tiracizina [INN-Spanish]
- Tiracizine [INN]
- Tiracizinum
- Tiracizinum [INN-Latin]
- Unii-9Uuo2T61K7
- [5-(2-Dimethylamino-acetyl)-10,11-dihydro-5H-dibenzo[b,f]azepin-3-yl]-carbamic acid ethyl ester
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
