CAS 83276-08-8
:4-piperidin-3-yl-1H-indole hydrochloride
Description:
4-Piperidin-3-yl-1H-indole hydrochloride is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a piperidine group at the 3-position of the indole enhances its potential for biological activity, making it of interest in medicinal chemistry. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is advantageous for formulation in pharmaceutical applications. The hydrochloride salt form indicates that it is a protonated version of the base, which often improves stability and solubility. Its molecular structure suggests potential interactions with biological targets, and it may exhibit properties such as analgesic, anti-inflammatory, or neuroprotective effects, although specific biological activities would require empirical investigation. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols due to potential toxicity or reactivity.
Formula:C13H17ClN2
InChI:InChI=1/C13H16N2.ClH/c1-4-11(10-3-2-7-14-9-10)12-6-8-15-13(12)5-1;/h1,4-6,8,10,14-15H,2-3,7,9H2;1H
SMILES:c1cc(C2CCCNC2)c2cc[nH]c2c1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.