CAS 83277-30-9
:5-(Hydroxymethyl)-3-(1-methylethyl)-2-oxazolidinone
Description:
5-(Hydroxymethyl)-3-(1-methylethyl)-2-oxazolidinone, identified by its CAS number 83277-30-9, is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits properties associated with heterocycles, including potential solubility in polar solvents due to the presence of hydroxymethyl and isopropyl groups. The hydroxymethyl group can participate in hydrogen bonding, enhancing its reactivity and interaction with other molecules. The isopropyl group contributes to the compound's hydrophobic characteristics, influencing its overall solubility and stability. This compound may be of interest in pharmaceutical applications, particularly in the development of antimicrobial agents or as intermediates in organic synthesis. Its unique structural features allow for various functional modifications, making it a versatile building block in chemical synthesis. As with all chemical substances, safety data and handling precautions should be consulted to ensure proper use and minimize risks.
Formula:C7H13NO3
InChI:InChI=1S/C7H13NO3/c1-5(2)8-3-6(4-9)11-7(8)10/h5-6,9H,3-4H2,1-2H3
InChI key:InChIKey=RXRVCSDDGFQDOJ-UHFFFAOYSA-N
SMILES:C(C)(C)N1C(=O)OC(CO)C1
Synonyms:- 5-(Hydroxymethyl)-3-(1-methylethyl)-2-oxazolidinone
- 2-Oxazolidinone, 5-(hydroxymethyl)-3-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
