CAS 833-52-3
:Umbelliferone-6-carboxylic acid
Description:
Umbelliferone-6-carboxylic acid, also known as 7-hydroxycoumarin-6-carboxylic acid, is a derivative of umbelliferone, a naturally occurring coumarin compound. This substance is characterized by its aromatic structure, which includes a benzopyran ring system. It features a hydroxyl group at the 7-position and a carboxylic acid group at the 6-position, contributing to its solubility in polar solvents. Umbelliferone-6-carboxylic acid exhibits fluorescence properties, making it useful in various analytical applications, including fluorescence spectroscopy. It is known for its potential biological activities, including antioxidant and anti-inflammatory effects, which have been the subject of research in pharmacology. Additionally, this compound can serve as a precursor in the synthesis of other chemical entities and is utilized in the study of biochemical pathways. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature, which are important considerations in experimental applications.
Formula:C10H6O5
InChI:InChI=1S/C10H6O5/c11-7-4-8-5(1-2-9(12)15-8)3-6(7)10(13)14/h1-4,11H,(H,13,14)
InChI key:InChIKey=SSYRTNYKCKNPJB-UHFFFAOYSA-N
SMILES:OC=1C=C2C(=CC1C(O)=O)C=CC(=O)O2
Synonyms:- 7-Hydroxycoumarin-6-carboxylic acid
- 2H-1-Benzopyran-6-carboxylic acid, 7-hydroxy-2-oxo-
- Umbelliferone-6-carboxylic acid
- 7-Hydroxy-2-oxo-2H-1-benzopyran-6-carboxylic acid
- 6-Carboxy-7-hydroxycoumarin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
