CAS 833-81-8
:trans-alpha-methylstilbene
Description:
Trans-alpha-methylstilbene is an organic compound characterized by its structure, which features a stilbene backbone with a methyl group attached to one of the phenyl rings. It is a member of the stilbene family, known for its trans configuration, which is crucial for its physical and chemical properties. This compound is typically a solid at room temperature and exhibits a crystalline form. Trans-alpha-methylstilbene is insoluble in water but soluble in organic solvents such as ethanol and acetone. It has applications in various fields, including organic synthesis and materials science, particularly in the development of photonic and electronic materials due to its ability to undergo photochemical reactions. Additionally, it has been studied for its potential biological activities, including its effects on cell signaling pathways. The compound's stability and reactivity can be influenced by factors such as temperature and the presence of light, making it an interesting subject for research in both chemistry and biochemistry.
Formula:C15H14
InChI:InChI=1S/C15H14/c1-13(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2-12H,1H3/b13-12+
Synonyms:- Stilbene, alpha-methyl-, (E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(E)-α-Methylstilbene, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C15H14Purity:98%Color and Shape:White to cream, Crystals or crystalline powderMolecular weight:194.28(2E)-1,2-Diphenyl-1-propene
CAS:Formula:C15H14Purity:97%Color and Shape:SolidMolecular weight:194.2717(E)-Prop-1-Ene-1,2-Diyldibenzene
CAS:(E)-Prop-1-Ene-1,2-DiyldibenzenePurity:97%Molecular weight:194.27g/mol




