CAS 83306-45-0
:3-fluoropropane-1,2-diamine
Description:
3-Fluoropropane-1,2-diamine is an organic compound characterized by the presence of a fluorine atom and two amine functional groups attached to a three-carbon propane backbone. This compound features a primary amine at the terminal carbon and a secondary amine at the second carbon, which can influence its reactivity and interactions with other molecules. The fluorine substituent can impart unique properties, such as increased polarity and potential for hydrogen bonding, which may enhance its solubility in polar solvents. 3-Fluoropropane-1,2-diamine is likely to exhibit basicity due to the presence of amine groups, making it a potential candidate for various applications in organic synthesis, pharmaceuticals, and materials science. Its structure allows for potential applications in drug development, particularly in the design of biologically active molecules. Safety and handling considerations should be taken into account, as with many amines, due to potential toxicity and reactivity. Overall, 3-fluoropropane-1,2-diamine is a versatile compound with interesting chemical properties stemming from its unique functional groups.
Formula:C3H9FN2
InChI:InChI=1/C3H9FN2/c4-1-3(6)2-5/h3H,1-2,5-6H2
SMILES:C(C(CN)N)F
Synonyms:- 1,2-Propanediamine, 3-fluoro-, (+-)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.