CAS 83315-69-9
:3-(azidopropyl)triethoxysilane
Description:
3-(Azidopropyl)triethoxysilane is an organosilicon compound characterized by the presence of a triethoxysilane group and an azidopropyl functional group. This compound typically features a silicon atom bonded to three ethoxy groups and one azidopropyl moiety, which introduces a reactive azide functional group. The presence of the azide group makes it a useful intermediate in click chemistry and other synthetic applications, allowing for further functionalization or coupling reactions. The ethoxy groups enhance the solubility of the compound in organic solvents and facilitate its use in silane coupling reactions, which are important in materials science, particularly in the modification of surfaces and the development of hybrid organic-inorganic materials. Additionally, the compound may exhibit properties such as moisture sensitivity due to the presence of ethoxy groups, which can hydrolyze in the presence of water, leading to the formation of silanol groups. Overall, 3-(azidopropyl)triethoxysilane is valued for its versatility in chemical synthesis and materials applications.
Formula:C9H21N3O3Si
InChI:InChI=1S/C9H21N3O3Si/c1-4-13-16(14-5-2,15-6-3)9-7-8-11-12-10/h4-9H2,1-3H3
InChI key:InChIKey=DHFNCWQATZVOGB-UHFFFAOYSA-N
SMILES:[Si](CCCN=[N+]=[N-])(OCC)(OCC)OCC
Synonyms:- 3-(Azidopropyl)triethoxysilane
- Einecs 280-374-1
- Silane,(3-azidopropyl)triethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(Azidopropyl)triethoxysilane
CAS:Formula:C9H21N3O3SiPurity:97%Color and Shape:LiquidMolecular weight:247.36683-(Azidopropyl)triethoxysilane
CAS:<p>3-(Azidopropyl)triethoxysilane is a chemical compound that is used as an immobilization agent for metal ions. It is typically synthesized by reacting triethoxysilane with azide and can be used to immobilize metal ions on the surface of various materials, such as glass, silicon, or other substrates. 3-(Azidopropyl)triethoxysilane has been shown to have anticancer activity in vitro against MCF-7 cells. This compound induces cancer cell death by binding to the cell membrane and disrupting its lipid bilayer. 3-(Azidopropyl)triethoxysilane also has a diameter of 6.3 nm, which allows it to cross the membrane easily.</p>Formula:C9H21N3O3SiPurity:Min. 95 Area-%Color and Shape:Clear LiquidMolecular weight:247.37 g/mol3-AZIDOPROPYLTRIETHOXYSILANE
CAS:<p>Azide Functional Trialkoxy Silane<br>Silane coupling agents have the ability to form a durable bond between organic and inorganic materials to generate desired heterogeneous environments or to incorporate the bulk properties of different phases into a uniform composite structure. The general formula has two classes of functionality. The hydrolyzable group forms stable condensation products with siliceous surfaces and other oxides such as those of aluminum, zirconium, tin, titanium, and nickel. The organofunctional group alters the wetting or adhesion characteristics of the substrate, utilizes the substrate to catalyze chemical transformations at the heterogeneous interface, orders the interfacial region, or modifies its partition characteristics, and significantly effects the covalent bond between organic and inorganic materials.<br>3-Azidopropyltriethoxysilane; Trimethoxysilylpropylazide<br>Used with click chemistry to introduce and immobilize discrete complexes onto the SBA-15 surfaceUsed in the preparation of poly-L-lysine bound to silica nanoparticlesCoupling agent for surface modificationAVOID CONTACT WITH METALS<br></p>Formula:C9H21N3O3SiPurity:97%Color and Shape:Straw Amber LiquidMolecular weight:247.373-(Azidopropyl)triethoxysilane
CAS:Formula:C9H21N3O3SiPurity:97%Color and Shape:LiquidMolecular weight:247.37




