CAS 83327-21-3
:4-Methoxyglucobrassicin
Description:
4-Methoxyglucobrassicin is a naturally occurring glucosinolate, a type of sulfur-containing compound found primarily in cruciferous vegetables such as broccoli, Brussels sprouts, and cabbage. This compound is notable for its potential health benefits, including antioxidant and anti-cancer properties, attributed to its ability to produce bioactive metabolites upon hydrolysis. Structurally, 4-Methoxyglucobrassicin consists of a glucose moiety linked to a methoxy-substituted indole, which contributes to its biological activity. It is soluble in water and polar organic solvents, making it bioavailable in various physiological environments. The compound is of interest in nutritional and pharmaceutical research due to its role in the plant's defense mechanisms and its implications for human health. Additionally, studies have suggested that glucosinolates like 4-Methoxyglucobrassicin may influence enzyme activity related to detoxification processes in the body. Overall, this compound exemplifies the intersection of plant chemistry and human health, highlighting the importance of dietary sources of glucosinolates in promoting wellness.
Formula:C17H22N2O10S2
InChI:InChI=1S/C17H22N2O10S2/c1-27-10-4-2-3-9-13(10)8(6-18-9)5-12(19-29-31(24,25)26)30-17-16(23)15(22)14(21)11(7-20)28-17/h2-4,6,11,14-18,20-23H,5,7H2,1H3,(H,24,25,26)/t11-,14-,15+,16-,17+/m1/s1
InChI key:InChIKey=IIAGSABLXRZUSE-UFRBAHOGSA-N
SMILES:C(C(S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)=NOS(=O)(=O)O)C=2C=3C(NC2)=CC=CC3OC
Synonyms:- β-D-Glucopyranose, 1-thio-, 1-[4-methoxy-N-(sulfooxy)-1H-indole-3-ethanimidate]
- 4-Methoxyindol-3-methyl glucosinolate
- 4-Methoxyglucobrassicin
- (4-Methoxy-3-indolylmethyl)glucosinolate
- 4-Methoxyglucobrassin
- N-METHOXY-3-INDOLYLMETHYL-GLUCOSINOLATE
- 4-Methoxy-3-indolylmethylglucosinolate K-salt from Brassica oleracea
- 4-methoxyglucobrassicin(1-)
- ((Z)-(2-(4-methoxy-1H-indol-3-yl)
- beta-D-Glucopyranose, 1-thio-, 1-(4-methoxy-N-(sulfooxy)-1H-indole-3-ethanimidate)
- N-(Sulfooxy)-4-methoxy-1H-indole-3-acetimidic acid O-(β-D-glucopyranosylthio) ester
- 4-Moimg
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Methoxyglucobrassicin potassium salt
CAS:4-Methoxyglucobrassicin potassium salt analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C17H21N2O10S2KPurity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:516.584-Methoxyglucobrassicin
CAS:Controlled ProductFormula:C17H22N2O10S2Color and Shape:NeatMolecular weight:478.494-Methoxyglucobrassicin
CAS:4-Methoxyglucobrassicin is a natural product for research related to life sciences. The catalog number is TN3051 and the CAS number is 83327-21-3.Formula:C17H22N2O10S2Purity:98%Color and Shape:SolidMolecular weight:478.494-Methoxyglucobrassicin potassium
CAS:4-Methoxyglucobrassicin potassium is a specialized glucosinolate derivative, which is naturally found in plants of the Brassicaceae family. This compound is sourced from cruciferous vegetables such as broccoli, Brussels sprouts, and kale. As a glucosinolate, it undergoes enzymatic hydrolysis by myrosinase to produce biologically active compounds known as isothiocyanates and indole-3-carbinols. These metabolites are of significant interest due to their potential roles in modulating various biochemical pathways, including those involved in detoxification and cellular signaling.
Formula:C17H22N2O10S2Purity:Min. 95%Molecular weight:478.50 g/molRef: 3D-IDA32721
Discontinued product




