CAS 83329-16-2

2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-N-nitrosobutan-1-amine

Description:

2,2,3,3,4,4,4-Heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-N-nitrosobutan-1-amine, with CAS number 83329-16-2, is a synthetic organic compound characterized by its complex fluorinated structure. This substance features multiple fluorine atoms, which contribute to its high stability and low reactivity, making it resistant to degradation in various environments. The presence of the nitroso group (-N=O) indicates potential reactivity, particularly in biological systems, where it may participate in nitrosation reactions. The compound is likely to be a colorless or pale yellow liquid, exhibiting low volatility due to its heavy fluorination. Its high electronegativity from the fluorine atoms imparts unique properties, such as low surface tension and high hydrophobicity. Additionally, the compound's potential applications may include use in specialized chemical processes or as a reagent in organic synthesis. However, due to the presence of nitrogen oxides, it may pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations.

Formula: C₈H₄F₁₄N₂O

InChI: InChI=1/C8H4F14N2O/c9-3(10,5(13,14)7(17,18)19)1-24(23-25)2-4(11,12)6(15,16)8(20,21)22/h1-2H2

SMILES: C(C(C(C(F)(F)F)(F)F)(F)F)N(CC(C(C(F)(F)F)(F)F)(F)F)N=O

Synonyms:

• 1-butanamine, 2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-N-nitroso-