CymitQuimica logo

CAS 83330-29-4

:

6-Chloro-2-(2-furanyl)-1H-benzimidazole

Description:
6-Chloro-2-(2-furanyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a chloro group and a furanyl moiety. The presence of the chloro group typically enhances the compound's reactivity and may influence its biological activity. The furanyl group, derived from furan, contributes to the compound's aromatic properties and can affect its solubility and interaction with other molecules. This compound is often studied for its potential pharmacological applications, particularly in medicinal chemistry, due to the presence of both the benzimidazole and furan rings, which are known to exhibit various biological activities. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 6-Chloro-2-(2-furanyl)-1H-benzimidazole represents a class of compounds that may have significant implications in drug development and other chemical applications.
Formula:C11H7ClN2O
InChI:InChI=1S/C11H7ClN2O/c12-7-3-4-8-9(6-7)14-11(13-8)10-2-1-5-15-10/h1-6H,(H,13,14)
InChI key:InChIKey=VYLYRJBQIPOPRK-UHFFFAOYSA-N
SMILES:ClC=1C=C2N=C(NC2=CC1)C3=CC=CO3
Synonyms:
  • Benzimidazole, 5(or 6)-chloro-2-(2-furyl)-
  • 1H-Benzimidazole, 6-chloro-2-(2-furanyl)-
  • 6-Chloro-2-(2-furanyl)-1H-benzimidazole
  • 1H-Benzimidazole, 5-chloro-2-(2-furanyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.