CAS 83335-32-4
:4,4,4-trifluoro-N-nitroso-N-(4,4,4-trifluorobutyl)butan-1-amine
Description:
4,4,4-Trifluoro-N-nitroso-N-(4,4,4-trifluorobutyl)butan-1-amine is a chemical compound characterized by its unique structure, which includes trifluoromethyl groups and a nitroso functional group. The presence of trifluoromethyl groups imparts significant lipophilicity and can influence the compound's reactivity and stability. The nitroso group is known for its potential to participate in various chemical reactions, including nitrosation and oxidation processes. This compound is likely to exhibit properties typical of nitrogen-containing compounds, such as potential toxicity and reactivity with nucleophiles. Its application may be relevant in fields such as organic synthesis, pharmaceuticals, or agrochemicals, although specific uses would depend on further research into its biological activity and environmental impact. Safety precautions are essential when handling this compound due to the presence of fluorine and nitroso groups, which can pose health risks. Overall, 4,4,4-trifluoro-N-nitroso-N-(4,4,4-trifluorobutyl)butan-1-amine represents a complex molecule with distinctive chemical properties.
Formula:C8H12F6N2O
InChI:InChI=1/C8H12F6N2O/c9-7(10,11)3-1-5-16(15-17)6-2-4-8(12,13)14/h1-6H2
SMILES:C(CC(F)(F)F)CN(CCCC(F)(F)F)N=O
Synonyms:- 1-butanamine, 4,4,4-trifluoro-N-nitroso-N-(4,4,4-trifluorobutyl)-
- 4,4,4-Trifluoro-N-nitroso-N-(4,4,4-trifluorobutyl)-1-butanamine
- 83335-32-4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.