CAS 83345-63-5
:9-[(2R,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxynonanoic acid
Description:
The chemical substance known as 9-[(2R,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxynonanoic acid, with the CAS number 83345-63-5, is a complex organic compound characterized by its unique structural features. It contains a nonanoic acid moiety linked to a tetrahydropyran ring that is substituted with multiple hydroxyl groups, indicating its potential as a polyol. The presence of these hydroxyl groups suggests that the compound may exhibit strong hydrogen bonding capabilities, which can influence its solubility and reactivity. Additionally, the stereochemistry of the tetrahydropyran ring, denoted by the specific R and S configurations, contributes to the compound's three-dimensional shape, potentially affecting its biological activity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and biochemistry, due to its structural complexity and potential functional properties. However, specific applications and biological effects would require further investigation and research.
Formula:C15H28O8
InChI:InChI=1/C15H28O8/c16-9-10-12(19)13(20)14(21)15(23-10)22-8-6-4-2-1-3-5-7-11(17)18/h10,12-16,19-21H,1-9H2,(H,17,18)/t10?,12-,13-,14?,15+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
9-(b-D-Galactopyranose)-nonanoic acid
CAS:9-(b-D-Galactopyranose)-nonanoic acid is a custom synthesis, modification and fluorination of a methylated monosaccharide in the form of an oligosaccharide. This synthetic compound is polysaccharide with a carbohydrate group at one end, which can be modified to be glycosylated or saccharified. It has been shown to have anti-inflammatory properties, which may be due to its ability to inhibit prostaglandin synthesis.Formula:C15H28O8Purity:Min. 95%Color and Shape:SolidMolecular weight:336.38 g/mol9-(β-D-Galactopyranosyloxy)nonanoic Acid
CAS:Controlled ProductApplications Used for preparation of sugar-modified polylysine derivatives as organ-targeting pharmaceutical carriers.
References Gonsho, A., et al.: Biol. Pharm. Bull., 17, 275 ( 1994),Formula:C15H28O8Color and Shape:NeatMolecular weight:336.38



