CAS 833472-82-5

[3-(3-methoxy-3-oxopropyl)phenyl]boronic acid

Description:

[3-(3-methoxy-3-oxopropyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a propyl chain that contains a methoxy and a ketone functional group, contributing to its reactivity and solubility properties. Typically, boronic acids exhibit moderate to high solubility in polar organic solvents, and their acidity can facilitate the formation of boronate esters with alcohols. This compound may also play a role in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is pivotal in the synthesis of complex organic molecules. Additionally, the presence of the methoxy group can influence the electronic properties of the molecule, potentially enhancing its reactivity or selectivity in chemical reactions. Overall, [3-(3-methoxy-3-oxopropyl)phenyl]boronic acid is a versatile building block in synthetic organic chemistry.

Formula: C₁₀H₁₃BO₄

InChI: InChI=1/C10H13BO4/c1-15-10(12)6-5-8-3-2-4-9(7-8)11(13)14/h2-4,7,13-14H,5-6H2,1H3

SMILES: COC(=O)CCc1cccc(c1)B(O)O

3-(2-Methoxycarbonylethyl)benzeneboronic acid, 97%

CAS: 833472-82-5

3-(2-Methoxycarbonylethyl)benzeneboronic acid is involved in the preparation of antimalarial and anticancer ethylenediamine inhibitors to protein farnesyltransferase. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and lab

Formula: C₁₀H₁₃BO₄

Purity: 97%

Molecular weight: 208.02

Ref: 02-H52542

METHYL 3-(3-BORONOPHENYL)PROPIONATE

CAS: 833472-82-5

Formula: C₁₀H₁₃BO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.0188

Ref: IN-DA004SEU

3-(2-Methoxycarbonylethyl)benzeneboronic acid

CAS: 833472-82-5

3-(2-Methoxycarbonylethyl)benzeneboronic acid

Formula: C₁₀H₁₃BO₄

Purity: 98%

Color and Shape: grey solid

Molecular weight: 208.01882g/mol

Ref: 54-OR13161

(3-(3-Methoxy-3-oxopropyl)phenyl)boronic acid

CAS: 833472-82-5

Formula: C₁₀H₁₃BO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.02

Ref: 10-F338223