CAS 83348-78-1
:1H-indolium-2-carboxylate, 1-[(2S)-2-amino-1-oxopropyl]-1-[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]-2,3-dihydro-, sodium salt, (2S)- (1:1)
Description:
1H-Indolium-2-carboxylate, 1-[(2S)-2-amino-1-oxopropyl]-1-[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]-2,3-dihydro-, sodium salt, (2S)- (1:1) is a complex organic compound characterized by its indolium structure, which features a fused bicyclic system containing a nitrogen atom. This compound exhibits properties typical of indole derivatives, including potential biological activity due to the presence of the indolium moiety. The carboxylate group contributes to its solubility in aqueous environments, while the sodium salt form enhances its stability and bioavailability. The presence of amino and ethoxycarbonyl substituents suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the stereochemistry indicated by the (2S) and (1S) designations implies specific spatial arrangements that may influence the compound's reactivity and interaction with enzymes or receptors. Overall, this compound's unique structure and functional groups position it as a candidate for further research in pharmacology and organic synthesis.
Formula:C24H28N2NaO5
InChI:InChI=1/C24H28N2O5.Na/c1-3-31-24(30)20(14-13-17-9-5-4-6-10-17)26(22(27)16(2)25)19-12-8-7-11-18(19)15-21(26)23(28)29;/h4-12,16,20-21H,3,13-15,25H2,1-2H3;/q;+1/t16-,20-,21-,26?;/m0./s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CGS 13928C
CAS:CGS 13928C is a potent converting enzyme inhibitorFormula:C24H27N2NaO5Color and Shape:SolidMolecular weight:446.48
