CAS 833482-53-4

2-(4-Fluorophenoxy)-N-methylbenzylamine

Description:

2-(4-Fluorophenoxy)-N-methylbenzylamine, with the CAS number 833482-53-4, is an organic compound characterized by its unique molecular structure, which includes a fluorophenyl group, a phenoxy linkage, and a N-methylbenzylamine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. As a result, it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The presence of the N-methyl group can affect the steric and electronic characteristics, which may play a role in its interaction with biological targets. Overall, 2-(4-Fluorophenoxy)-N-methylbenzylamine is a compound that may exhibit diverse chemical behavior and potential applications in various fields, including drug discovery and chemical synthesis.

Formula: C₁₄H₁₄FNO

InChI: InChI=1/C14H14FNO/c1-16-10-11-4-2-3-5-14(11)17-13-8-6-12(15)7-9-13/h2-9,16H,10H2,1H3

SMILES: CNCc1ccccc1Oc1ccc(cc1)F

Synonyms:

• benzenemethanamine, 2-(4-fluorophenoxy)-N-methyl-
• 1-[2-(4-fluorophenoxy)phenyl]-N-methylmethanamine

1-[2-(4-FLUOROPHENOXY)PHENYL]-N-METHYLMETHYLAMINE

CAS: 833482-53-4

Formula: C₁₄H₁₄FNO

Molecular weight: 231.2655

Ref: IN-DA003EW7