CAS 833483-46-8

3-Pyrrolidinamine, 1-(1-oxopropyl)-

Description:

3-Pyrrolidinamine, 1-(1-oxopropyl)-, identified by its CAS number 833483-46-8, is an organic compound characterized by a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound features an amine functional group, contributing to its basicity and potential reactivity in various chemical reactions. The presence of the 1-(1-oxopropyl) substituent indicates that it has a carbonyl group (ketone) attached to a propyl chain, which can influence its chemical behavior, including its ability to participate in nucleophilic addition reactions. The molecular structure suggests that it may exhibit properties typical of both amines and ketones, such as hydrogen bonding capabilities and varying solubility in polar and nonpolar solvents. Additionally, compounds with similar structures are often investigated for their biological activity, making them of interest in medicinal chemistry. Overall, 3-Pyrrolidinamine, 1-(1-oxopropyl)- is a compound that combines features of cyclic amines and carbonyl-containing groups, potentially leading to diverse applications in chemical synthesis and pharmaceuticals.

Formula: C₇H₁₄N₂O

InChI: InChI=1S/C7H14N2O/c1-2-7(10)9-4-3-6(8)5-9/h6H,2-5,8H2,1H3

InChI key: InChIKey=KDDFKAWLZGLKKF-UHFFFAOYSA-N

SMILES: C(CC)(=O)N1CC(N)CC1

Synonyms:

• 1-(3-Amino-1-pyrrolidinyl)-1-propanone
• 1-Propanone, 1-(3-amino-1-pyrrolidinyl)-
• 3-Pyrrolidinamine, 1-(1-oxopropyl)-
• 1-(3-aminopyrrolidin-1-yl)propan-1-one

1-(3-Aminopyrrolidin-1-yl)propan-1-one

CAS: 833483-46-8

Versatile small molecule scaffold

Formula: C₇H₁₄N₂O

Purity: Min. 95%

Molecular weight: 142.2 g/mol

Ref: 3D-IIB48346