CAS 83364-15-2

N-[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]acetamide

Description:

N-[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]acetamide, with the CAS number 83364-15-2, is a chemical compound that belongs to the class of triazine derivatives. It features a triazine ring, which is a six-membered heterocyclic structure containing three nitrogen atoms and three carbon atoms. The presence of a chloro substituent and an isopropylamino group contributes to its unique reactivity and potential biological activity. This compound is typically characterized by its moderate solubility in polar solvents and may exhibit specific interactions with biological targets, making it of interest in agricultural and pharmaceutical applications. Its structure suggests potential use as a herbicide or in other agrochemical formulations, as triazine derivatives are commonly employed in these fields. Additionally, the acetamide functional group may enhance its stability and solubility properties. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or environmental impact.

Formula: C₈H₁₂ClN₅O

InChI: InChI=1/C8H12ClN5O/c1-4(2)10-7-12-6(9)13-8(14-7)11-5(3)15/h4H,1-3H3,(H2,10,11,12,13,14,15)

SMILES: CC(C)N=c1nc(Cl)nc(N=C(C)O)[nH]1

Synonyms:

• acetamide, N-[4-chloro-6-[(1-methylethyl)amino]-1,3,5-triazin-2-yl]-

2-Chloro-4-acetamido-6-(isopropylamino)-s-triazine

Controlled Product

CAS: 83364-15-2

Formula: C₈H₁₂ClN₅O

Color and Shape: Neat

Molecular weight: 229.667

Ref: TR-C363420