CAS 83396-76-3

2-(acetylamino)-3-(2-thienyl)propanoic acid

Description:

2-(Acetylamino)-3-(2-thienyl)propanoic acid, with the CAS number 83396-76-3, is an organic compound characterized by its unique structure that includes an acetylamino group and a thienyl moiety. This compound typically exhibits properties associated with both amino acids and thienyl derivatives, such as potential solubility in polar solvents due to the presence of the carboxylic acid and amine functionalities. The thienyl group may impart specific electronic properties and influence the compound's reactivity and interactions with biological systems. It may also exhibit biological activity, making it of interest in pharmaceutical research. The presence of the acetylamino group suggests that it could participate in various chemical reactions, including acylation and amidation. Overall, this compound's characteristics make it a subject of interest in organic synthesis and medicinal chemistry, where its structural features could be leveraged for developing new therapeutic agents.

Formula: C₉H₁₁NO₃S

InChI: InChI=1/C9H11NO3S/c1-6(11)10-8(9(12)13)5-7-3-2-4-14-7/h2-4,8H,5H2,1H3,(H,10,11)(H,12,13)/t8-/m0/s1

SMILES: CC(=N[C@@H](Cc1cccs1)C(=O)O)O

Synonyms:

• N-acetyl-3-thiophen-2-yl-L-alanine