CAS 83407-42-5

N~6~,7-dimethylquinoline-5,6-diamine

Description:

N~6~,7-dimethylquinoline-5,6-diamine, with the CAS number 83407-42-5, is an organic compound that belongs to the class of quinoline derivatives. This substance features a quinoline backbone, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of two methyl groups at the N-6 and N-7 positions, along with amino groups at the 5 and 6 positions, contributes to its unique chemical properties. Typically, compounds of this nature exhibit moderate to high solubility in organic solvents, while their solubility in water can vary. The amino groups can participate in hydrogen bonding, influencing the compound's reactivity and interactions with other molecules. N~6~,7-dimethylquinoline-5,6-diamine may also exhibit biological activity, making it of interest in medicinal chemistry and research. Its structural features suggest potential applications in dye synthesis, as well as in the development of pharmaceuticals or agrochemicals, depending on its specific reactivity and biological properties.

Formula: C₁₁H₁₃N₃

InChI: InChI=1/C11H13N3/c1-7-6-9-8(4-3-5-14-9)10(12)11(7)13-2/h3-6,13H,12H2,1-2H3

SMILES: Cc1cc2c(cccn2)c(c1NC)N