CAS 83410-38-2
:4-Pyrimidinecarboxylic acid, 5-bromo-2-methyl-, ethyl ester
Description:
4-Pyrimidinecarboxylic acid, 5-bromo-2-methyl-, ethyl ester, with the CAS number 83410-38-2, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. The presence of a bromine atom at the 5-position and a methyl group at the 2-position of the pyrimidine ring introduces specific steric and electronic effects, which can influence its chemical behavior and potential applications. Typically, such compounds may exhibit biological activity, making them of interest in pharmaceutical research. The ethyl ester form suggests that it may be more lipophilic compared to its acid counterpart, potentially affecting its absorption and distribution in biological systems. Overall, this compound's unique structural features make it a subject of interest in various fields, including medicinal chemistry and agrochemicals.
Formula:C8H9BrN2O2
InChI:InChI=1S/C8H9BrN2O2/c1-3-13-8(12)7-6(9)4-10-5(2)11-7/h4H,3H2,1-2H3
InChI key:InChIKey=JGNFJQXAJBLYED-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(Br)=CN=C(C)N1
Synonyms:- 4-Pyrimidinecarboxylic acid, 5-bromo-2-methyl-, ethyl ester
- Ethyl 5-Bromo-2-Methyl-Pyrimidine-4-Carboxylate
- Ethyl 5-bromo-2-methyl-4-pyrimidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
