CAS 83417-23-6

5-(Pyridin-2-yl)-4H-1,2,4-triazol-3-amine

Description:

5-(Pyridin-2-yl)-4H-1,2,4-triazol-3-amine, with the CAS number 83417-23-6, is a chemical compound characterized by its triazole and pyridine functional groups. This compound features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms, contributing to its potential biological activity. The presence of the pyridine moiety enhances its solubility and reactivity, making it of interest in various fields, including medicinal chemistry and agrochemicals. The amine group in the structure can participate in hydrogen bonding, influencing its interactions with biological targets. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, depending on its specific interactions and modifications. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-(Pyridin-2-yl)-4H-1,2,4-triazol-3-amine is a versatile compound with potential applications in drug development and research.

Formula: C₇H₇N₅

InChI: InChI=1/C7H7N5/c8-7-10-6(11-12-7)5-3-1-2-4-9-5/h1-4H,(H3,8,10,11,12)

SMILES: c1ccnc(c1)c1nc(=N)[nH][nH]1

Synonyms:

• 3-Amino-5-(2-pyridyl)-1,2,4-triazole
• 3-pyridin-2-yl-1H-1,2,4-triazol-5-amine

1H-1,2,4-Triazol-5-amine,3-(2-pyridinyl)-

CAS: 83417-23-6

Formula: C₇H₇N₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 161.1640

Ref: IN-DA004RTB

3-(Pyridin-2-yl)-1H-1,2,4-triazol-5-amine

CAS: 83417-23-6

3-(Pyridin-2-yl)-1H-1,2,4-triazol-5-amine

Purity: 97%

Molecular weight: 161.16g/mol

Ref: 54-OR85475

5-(pyridin-2-yl)-4H-1,2,4-triazol-3-amine

CAS: 83417-23-6

Purity: 97%

Molecular weight: 161.1679993

Ref: 10-F605317

5-(pyridin-2-yl)-4H-1,2,4-triazol-3-amine

CAS: 83417-23-6

5-(Pyridin-2-yl)-4H-1,2,4-triazol-3-amine is a heterocyclic compound that can be synthesized from 2-aminopyridine and 1,2-dihydropyridinium azide. It contains a 5-(pyridin-2-yl) group and a triazole ring in the same molecule. The 5-(pyridin-2-yl) group is attached to the nitrogen atom of the triazole ring by an N=N bond. This heterocyclic compound has been shown to chelate metal ions in biological systems. The coordinated metal ion can influence the coordination geometry of the ligand, which can lead to changes in reactivity.
5-(Pyridin-2-yl)-4H-[1,2,4]triazol-[3]amine is soluble in water and ethanol and has a melting point

Formula: C₇H₇N₅

Purity: Min. 95%

Molecular weight: 161.16 g/mol

Ref: 3D-IDA41723