CAS 83417-25-8
:3-(3-Pyridinylmethyl)-1H-1,2,4-triazol-5-amine
Description:
3-(3-Pyridinylmethyl)-1H-1,2,4-triazol-5-amine, with the CAS number 83417-25-8, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a pyridinylmethyl group, indicating the presence of a pyridine ring attached via a methylene bridge. The compound exhibits properties typical of triazoles, including potential biological activity, making it of interest in medicinal chemistry and drug development. Its amine functional group contributes to its reactivity and solubility in various solvents. The presence of both the triazole and pyridine moieties suggests potential applications in areas such as antifungal, antibacterial, or anticancer research. Additionally, the compound's structural characteristics may influence its interaction with biological targets, making it a subject of study for its pharmacological properties. Overall, 3-(3-Pyridinylmethyl)-1H-1,2,4-triazol-5-amine represents a versatile scaffold in the field of organic and medicinal chemistry.
Formula:C8H9N5
InChI:InChI=1S/C8H9N5/c9-8-11-7(12-13-8)4-6-2-1-3-10-5-6/h1-3,5H,4H2,(H3,9,11,12,13)
InChI key:InChIKey=BXZMHDLPJRBVDQ-UHFFFAOYSA-N
SMILES:C(C1=NN=C(N)N1)C=2C=CC=NC2
Synonyms:- 3-Amino-5-(3-pyridylmethyl)-1,2,4-triazole
- 3-(3-Pyridinylmethyl)-1H-1,2,4-triazol-5-amine
- 1H-1,2,4-Triazol-3-amine, 5-(3-pyridinylmethyl)-
- 1H-1,2,4-Triazol-5-amine, 3-(3-pyridinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.