CAS 83419-49-2

6′-Chlorospiro[cyclopropane-1,3′-[3H]indol]-2′(1′H)-one

Description:

6′-Chlorospiro[cyclopropane-1,3′-[3H]indol]-2′(1′H)-one, identified by its CAS number 83419-49-2, is a chemical compound characterized by its unique spirocyclic structure, which includes a cyclopropane ring fused to an indole moiety. This compound typically exhibits properties associated with both heterocycles and spiro compounds, such as potential biological activity and interesting reactivity due to the presence of the chlorine substituent. The indole portion of the molecule may contribute to its pharmacological properties, as indole derivatives are often found in various natural products and pharmaceuticals. The presence of the spirocyclic framework can influence the compound's conformational flexibility and steric interactions, which are crucial for its biological activity. Additionally, the chlorinated position may enhance lipophilicity and affect the compound's solubility in organic solvents. Overall, 6′-Chlorospiro[cyclopropane-1,3′-[3H]indol]-2′(1′H)-one represents a class of compounds that may have applications in medicinal chemistry and materials science, warranting further investigation into its properties and potential uses.

Formula: C₁₀H₈ClNO

InChI: InChI=1S/C10H8ClNO/c11-6-1-2-7-8(5-6)12-9(13)10(7)3-4-10/h1-2,5H,3-4H2,(H,12,13)

InChI key: InChIKey=QDUSZHHHSAODBW-UHFFFAOYSA-N

SMILES: O=C1C2(C=3C(N1)=CC(Cl)=CC3)CC2

Synonyms:

• 6′-Chlorospiro[cyclopropane-1,3′-indolin]-2′-one
• Spiro[cyclopropane-1,3′-[3H]indol]-2′(1′H)-one, 6′-chloro-
• 6′-Chlorospiro[cyclopropane-1,3′-[3H]indol]-2′(1′H)-one