CAS 83427-51-4
:5-(2-chlorobenzyl)-5,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2(4H)-one
Description:
5-(2-Chlorobenzyl)-5,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2(4H)-one is a chemical compound characterized by its unique bicyclic structure, which includes a thieno[3,2-c]pyridine core. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a chlorobenzyl substituent that enhances its lipophilicity and potential biological activity. The presence of the chlorine atom on the benzyl group can influence the compound's reactivity and interaction with biological targets. This substance is often studied for its pharmacological properties, particularly in the context of neuropharmacology and potential therapeutic applications. Its molecular structure suggests it may exhibit properties such as modulation of neurotransmitter systems or other biological pathways. As with many heterocyclic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C14H14ClNOS
InChI:InChI=1/C14H14ClNOS/c15-12-4-2-1-3-10(12)8-16-6-5-13-11(9-16)7-14(17)18-13/h1-4,7,13H,5-6,8-9H2
SMILES:c1ccc(c(c1)CN1CCC2C(=CC(=O)S2)C1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.