CAS 83431-75-8

Methyl 7-fluoro-1H-benzimidazole-2-carboxylate

Description:

Methyl 7-fluoro-1H-benzimidazole-2-carboxylate, with the CAS number 83431-75-8, is a chemical compound characterized by its benzimidazole core structure, which is a bicyclic compound featuring a fused benzene and imidazole ring. The presence of a methyl ester group at the carboxylate position enhances its solubility in organic solvents, making it useful in various chemical applications. The fluorine atom at the 7-position contributes to its unique reactivity and potential biological activity, as halogenated compounds often exhibit altered pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can influence biological interactions. Additionally, its synthesis and characterization involve standard organic chemistry techniques, including nucleophilic substitution and esterification reactions. Overall, Methyl 7-fluoro-1H-benzimidazole-2-carboxylate represents a versatile scaffold for further chemical modifications and applications in drug discovery and development.

Formula: C₉H₇FN₂O₂

InChI: InChI=1S/C9H7FN2O2/c1-14-9(13)8-11-6-4-2-3-5(10)7(6)12-8/h2-4H,1H3,(H,11,12)

InChI key: InChIKey=UEFROEPGMCYBEU-UHFFFAOYSA-N

SMILES: FC1=C2C(NC(C(OC)=O)=N2)=CC=C1

Synonyms:

• Methyl 7-fluoro-1H-benzimidazole-2-carboxylate
• 1H-Benzimidazole-2-carboxylic acid, 7-fluoro-, methyl ester
• 1H-Benzimidazole-2-carboxylic acid, 4-fluoro-, methyl ester