CAS 83455-48-5
:Bromerguride
Description:
Bromerguride, with the CAS number 83455-48-5, is a chemical compound that belongs to the class of benzamide derivatives. It is primarily recognized for its pharmacological properties, particularly as an antipsychotic and antiemetic agent. The compound exhibits a complex structure that includes bromine and mercury, which contribute to its biological activity. Bromerguride functions by modulating neurotransmitter systems, particularly dopamine receptors, making it relevant in the treatment of various psychiatric disorders. Its solubility characteristics and stability can vary based on environmental conditions, which is important for its formulation in pharmaceutical applications. Additionally, safety and handling precautions are essential due to the presence of mercury, a toxic element. As with many compounds, the therapeutic use of Bromerguride must be balanced with potential side effects and toxicity, necessitating careful consideration in clinical settings. Overall, Bromerguride represents a unique intersection of organic chemistry and medicinal applications, highlighting the importance of understanding both its chemical properties and biological implications.
Formula:C20H25BrN4O
InChI:InChI=1/C20H25BrN4O/c1-4-25(5-2)20(26)22-12-9-14-13-7-6-8-16-18(13)15(19(21)23-16)10-17(14)24(3)11-12/h6-9,12,17,23H,4-5,10-11H2,1-3H3,(H,22,26)/t12-,17+/m0/s1
Synonyms:- Bromerguride [INN]
- Bromergurida
- Bromergurida [Spanish]
- Bromerguridum
- Bromerguridum [Latin]
- Unii-Hx58M2377W
- 3-(2-Bromo-9,10-didehydro-6-methylergolin-8alpha-yl)-1,1-diethylurea
- 3-[(8Alpha)-2-Bromo-6-Methyl-9,10-Didehydroergolin-8-Yl]-1,1-Diethylurea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Bromerguride
CAS:Bromerguride is a dopamine antagonist with the activity of antipsychotic.Formula:C20H25BrN4OColor and Shape:SolidMolecular weight:417.34
