CAS 83455-49-6
:Urea, N′-[(8α)-2-bromo-9,10-didehydro-6-methylergolin-8-yl]-N,N-diethyl-, monohydrobromide
Description:
The chemical substance known as Urea, N′-[(8α)-2-bromo-9,10-didehydro-6-methylergolin-8-yl]-N,N-diethyl-, monohydrobromide, with the CAS number 83455-49-6, is a complex organic compound that features a urea functional group linked to a substituted ergoline structure. This compound is characterized by the presence of a bromine atom, which contributes to its reactivity and potential biological activity. The diethyl groups attached to the nitrogen atoms of the urea moiety enhance its lipophilicity, potentially influencing its pharmacokinetic properties. The monohydrobromide form indicates that the compound exists as a salt, which may affect its solubility and stability in various solvents. Such compounds are often of interest in medicinal chemistry due to their potential applications in drug development, particularly in the context of neurological or psychiatric disorders, given the ergoline framework's historical association with psychoactive substances. Overall, this compound's unique structural features suggest a range of possible interactions and effects in biological systems.
Formula:C20H25BrN4O·BrH
InChI:InChI=1S/C20H25BrN4O.BrH/c1-4-25(5-2)20(26)22-12-9-14-13-7-6-8-16-18(13)15(19(21)23-16)10-17(14)24(3)11-12;/h6-9,12,17,23H,4-5,10-11H2,1-3H3,(H,22,26);1H/t12-,17+;/m0./s1
InChI key:InChIKey=DXVYMWKQERXJJD-LWHGMNCYSA-N
SMILES:BrC1=C2C=3C(C=4[C@@](C2)(N(C)C[C@@H](NC(N(CC)CC)=O)C4)[H])=CC=CC3N1.Br
Synonyms:- Urea, N′-[(8α)-2-bromo-9,10-didehydro-6-methylergolin-8-yl]-N,N-diethyl-, monohydrobromide
- Ergoline, urea deriv.
- Indolo[4,3-fg]quinoline, urea deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
